C23H25N5S — CID 58910757
4-N,4-N-diethyl-1-N-[4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-yl]-2-methylbenzene-1,4-diamine (PubChem CID 58910757) has the molecular formula C23H25N5S and a molecular weight of 403.56 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-[4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-yl]-2-methylbenzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N-[4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-yl]-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 58910757 |
| Molecular Formula | C23H25N5S |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-[4-(4-imidazol-1-ylphenyl)-1,3-thiazol-2-yl]-2-methylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(-c3ccc(-n4ccnc4)cc3)cs2)c(C)c1 |
| InChI | InChI=1S/C23H25N5S/c1-4-27(5-2)20-10-11-21(17(3)14-20)25-23-26-22(15-29-23)18-6-8-19(9-7-18)28-13-12-24-16-28/h6-16H,4-5H2,1-3H3,(H,25,26) |
| InChIKey | ZAYVDODIKJTELC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|