C32H22O12 — CID 58911350
2,4-diacetyl-3-[3-acetyl-4-hydroxy-5-(2,4,5-trihydroxybenzoyl)phenyl]-6,7-dihydroxyxanthen-9-one (PubChem CID 58911350) has the molecular formula C32H22O12 and a molecular weight of 598.52 g/mol. Its IUPAC name is 2,4-diacetyl-3-[3-acetyl-4-hydroxy-5-(2,4,5-trihydroxybenzoyl)phenyl]-6,7-dihydroxyxanthen-9-one.
| Compound Name | 2,4-diacetyl-3-[3-acetyl-4-hydroxy-5-(2,4,5-trihydroxybenzoyl)phenyl]-6,7-dihydroxyxanthen-9-one |
|---|---|
| PubChem CID | 58911350 |
| Molecular Formula | C32H22O12 |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | 2,4-diacetyl-3-[3-acetyl-4-hydroxy-5-(2,4,5-trihydroxybenzoyl)phenyl]-6,7-dihydroxyxanthen-9-one |
| SMILES | CC(=O)c1cc(-c2c(C(C)=O)cc3c(=O)c4cc(O)c(O)cc4oc3c2C(C)=O)cc(C(=O)c2cc(O)c(O)cc2O)c1O |
| InChI | InChI=1S/C32H22O12/c1-11(33)15-6-20-31(43)18-8-23(38)25(40)10-26(18)44-32(20)27(13(3)35)28(15)14-4-16(12(2)34)29(41)19(5-14)30(42)17-7-22(37)24(39)9-21(17)36/h4-10,36-41H,1-3H3 |
| InChIKey | DWLUWXQGBOWMDL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 219.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|