C10H15F3 — CID 58911970
(3E)-2,6,6-trifluoro-8-methylnona-1,3-diene (PubChem CID 58911970) has the molecular formula C10H15F3 and a molecular weight of 192.22 g/mol. Its IUPAC name is (3E)-2,6,6-trifluoro-8-methylnona-1,3-diene.
| Compound Name | (3E)-2,6,6-trifluoro-8-methylnona-1,3-diene |
|---|---|
| PubChem CID | 58911970 |
| Molecular Formula | C10H15F3 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | (3E)-2,6,6-trifluoro-8-methylnona-1,3-diene |
| SMILES | C=C(F)/C=C/CC(F)(F)CC(C)C |
| InChI | InChI=1S/C10H15F3/c1-8(2)7-10(12,13)6-4-5-9(3)11/h4-5,8H,3,6-7H2,1-2H3/b5-4+ |
| InChIKey | RGNREWMQJBIJLW-SNAWJCMRSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|