C33H41N3O4Si2 — CID 58912254
(6-cyano-1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-5'-yl) 2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetate (PubChem CID 58912254) has the molecular formula C33H41N3O4Si2 and a molecular weight of 599.88 g/mol. Its IUPAC name is (6-cyano-1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-5'-yl) 2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetate.
| Compound Name | (6-cyano-1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-5'-yl) 2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetate |
|---|---|
| PubChem CID | 58912254 |
| Molecular Formula | C33H41N3O4Si2 |
| Molecular Weight | 599.88 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | (6-cyano-1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-5'-yl) 2-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]acetate |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CC(=O)Oc1ccc2c(c1)C(C)(C)C1(C=Nc3c(cc(C#N)c4ccccc34)O1)N2C |
| InChI | InChI=1S/C33H41N3O4Si2/c1-9-10-17-41(5,6)40-42(7,8)21-30(37)38-24-15-16-28-27(19-24)32(2,3)33(36(28)4)22-35-31-26-14-12-11-13-25(26)23(20-34)18-29(31)39-33/h11-16,18-19,22H,9-10,17,21H2,1-8H3 |
| InChIKey | PQJWHSZAZRZPKM-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 84.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.88 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|