C34H29F6N3O3 — CID 58913245
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1,3-dioxoisoindol-2-yl)-4-spiro[indene-1,4'-piperidine]-1'-ylbutanamide (PubChem CID 58913245) has the molecular formula C34H29F6N3O3 and a molecular weight of 641.61 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1,3-dioxoisoindol-2-yl)-4-spiro[indene-1,4'-piperidine]-1'-ylbutanamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1,3-dioxoisoindol-2-yl)-4-spiro[indene-1,4'-piperidine]-1'-ylbutanamide |
|---|---|
| PubChem CID | 58913245 |
| Molecular Formula | C34H29F6N3O3 |
| Molecular Weight | 641.61 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(1,3-dioxoisoindol-2-yl)-4-spiro[indene-1,4'-piperidine]-1'-ylbutanamide |
| SMILES | O=C(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(CCN1CCC2(C=Cc3ccccc32)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C34H29F6N3O3/c35-33(36,37)23-17-21(18-24(19-23)34(38,39)40)20-41-29(44)28(43-30(45)25-6-2-3-7-26(25)31(43)46)10-14-42-15-12-32(13-16-42)11-9-22-5-1-4-8-27(22)32/h1-9,11,17-19,28H,10,12-16,20H2,(H,41,44) |
| InChIKey | SZRNFKNSHZUSAP-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.61 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|