C23H29NO5 — CID 58913347
tert-butyl (2R)-2-[(1R)-2-[(4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]cyclopropyl]pent-4-enoate (PubChem CID 58913347) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(1R)-2-[(4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]cyclopropyl]pent-4-enoate.
| Compound Name | tert-butyl (2R)-2-[(1R)-2-[(4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]cyclopropyl]pent-4-enoate |
|---|---|
| PubChem CID | 58913347 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | tert-butyl (2R)-2-[(1R)-2-[(4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]cyclopropyl]pent-4-enoate |
| SMILES | C=CC[C@@H](C(=O)OC(C)(C)C)[C@@H]1CC1C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO5/c1-5-9-17(21(26)29-23(2,3)4)18-13-19(18)20(25)24-16(14-28-22(24)27)12-15-10-7-6-8-11-15/h5-8,10-11,16-19H,1,9,12-14H2,2-4H3/t16-,17-,18+,19?/m1/s1 |
| InChIKey | NJFOEINNRLECGP-KAKFPZCNSA-N |
| XLogP | 3.75 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|