C9H9F11O2 — CID 58913817
1,1,4-trifluoro-2-(fluoromethyl)-1-[2,2,3,3-tetrafluoro-1-(trifluoromethoxy)propoxy]butane (PubChem CID 58913817) has the molecular formula C9H9F11O2 and a molecular weight of 358.15 g/mol. Its IUPAC name is 1,1,4-trifluoro-2-(fluoromethyl)-1-[2,2,3,3-tetrafluoro-1-(trifluoromethoxy)propoxy]butane.
| Compound Name | 1,1,4-trifluoro-2-(fluoromethyl)-1-[2,2,3,3-tetrafluoro-1-(trifluoromethoxy)propoxy]butane |
|---|---|
| PubChem CID | 58913817 |
| Molecular Formula | C9H9F11O2 |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 1,1,4-trifluoro-2-(fluoromethyl)-1-[2,2,3,3-tetrafluoro-1-(trifluoromethoxy)propoxy]butane |
| SMILES | FCCC(CF)C(F)(F)OC(OC(F)(F)F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H9F11O2/c10-2-1-4(3-11)8(16,17)21-6(22-9(18,19)20)7(14,15)5(12)13/h4-6H,1-3H2 |
| InChIKey | XXCDQRBZFVROGN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|