About 4-(4,5-diaminopyrazol-1-yl)butanamide
4-(4,5-diaminopyrazol-1-yl)butanamide (PubChem CID 58913950) has the molecular formula C7H13N5O
and a molecular weight of 183.22 g/mol. Its IUPAC name is 4-(4,5-diaminopyrazol-1-yl)butanamide.
Molecular Properties
| Compound Name | 4-(4,5-diaminopyrazol-1-yl)butanamide |
| PubChem CID | 58913950 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 4-(4,5-diaminopyrazol-1-yl)butanamide |
| SMILES | NC(=O)CCCn1ncc(N)c1N |
| InChI | InChI=1S/C7H13N5O/c8-5-4-11-12(7(5)10)3-1-2-6(9)13/h4H,1-3,8,10H2,(H2,9,13) |
| InChIKey | UIDJKMLVPCSZJK-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4,5-diaminopyrazol-1-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-diaminopyrazol-1-yl)butanamide?
The IUPAC name of 4-(4,5-diaminopyrazol-1-yl)butanamide (CID 58913950) is 4-(4,5-diaminopyrazol-1-yl)butanamide.
What is the SMILES notation for 4-(4,5-diaminopyrazol-1-yl)butanamide?
The canonical SMILES for 4-(4,5-diaminopyrazol-1-yl)butanamide is NC(=O)CCCn1ncc(N)c1N.
What is the InChIKey of 4-(4,5-diaminopyrazol-1-yl)butanamide?
The InChIKey is UIDJKMLVPCSZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5O/c8-5-4-11-12(7(5)10)3-1-2-6(9)13/h4H,1-3,8,10H2,(H2,9,13).
What are the key properties of 4-(4,5-diaminopyrazol-1-yl)butanamide?
4-(4,5-diaminopyrazol-1-yl)butanamide has a molecular weight of 183.22 g/mol, XLogP of -0.69, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-diaminopyrazol-1-yl)butanamide is sourced from PubChem (CID 58913950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).