About 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine
2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine (PubChem CID 58914517) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine.
Molecular Properties
| Compound Name | 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine |
| PubChem CID | 58914517 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine |
| SMILES | CCC1=NCCCN1C1CCC(C)CC1 |
| InChI | InChI=1S/C13H24N2/c1-3-13-14-9-4-10-15(13)12-7-5-11(2)6-8-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | GQBLJFQAWDDLNA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine?
The IUPAC name of 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine (CID 58914517) is 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine.
What is the SMILES notation for 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine?
The canonical SMILES for 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine is CCC1=NCCCN1C1CCC(C)CC1.
What is the InChIKey of 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine?
The InChIKey is GQBLJFQAWDDLNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-3-13-14-9-4-10-15(13)12-7-5-11(2)6-8-12/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine?
2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine has a molecular weight of 208.35 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-(4-methylcyclohexyl)-5,6-dihydro-4H-pyrimidine is sourced from PubChem (CID 58914517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).