About (4-iodophenoxy)phosphane
(4-iodophenoxy)phosphane (PubChem CID 58914668) has the molecular formula C6H6IOP
and a molecular weight of 251.99 g/mol. Its IUPAC name is (4-iodophenoxy)phosphane.
Molecular Properties
| Compound Name | (4-iodophenoxy)phosphane |
| PubChem CID | 58914668 |
| Molecular Formula | C6H6IOP |
| Molecular Weight | 251.99 g/mol |
| Exact Mass | 251.92 |
| IUPAC Name | (4-iodophenoxy)phosphane |
| SMILES | POc1ccc(I)cc1 |
| InChI | InChI=1S/C6H6IOP/c7-5-1-3-6(8-9)4-2-5/h1-4H,9H2 |
| InChIKey | LDDBGBZRKRDYMN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.99 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-iodophenoxy)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodophenoxy)phosphane?
The IUPAC name of (4-iodophenoxy)phosphane (CID 58914668) is (4-iodophenoxy)phosphane.
What is the SMILES notation for (4-iodophenoxy)phosphane?
The canonical SMILES for (4-iodophenoxy)phosphane is POc1ccc(I)cc1.
What is the InChIKey of (4-iodophenoxy)phosphane?
The InChIKey is LDDBGBZRKRDYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6IOP/c7-5-1-3-6(8-9)4-2-5/h1-4H,9H2.
What are the key properties of (4-iodophenoxy)phosphane?
(4-iodophenoxy)phosphane has a molecular weight of 251.99 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodophenoxy)phosphane is sourced from PubChem (CID 58914668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).