About (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid
(3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid (PubChem CID 58915156) has the molecular formula C14H19NO3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid.
Molecular Properties
| Compound Name | (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid |
| PubChem CID | 58915156 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid |
| SMILES | CCCC[C@@]1(C)C(C)=Nc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C14H19NO3S/c1-4-5-8-14(3)10(2)15-13-7-6-11(9-12(13)14)19(16,17)18/h6-7,9H,4-5,8H2,1-3H3,(H,16,17,18)/t14-/m0/s1 |
| InChIKey | YIOAWJNDESFUGW-AWEZNQCLSA-N |
| XLogP | 3.49 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid?
The IUPAC name of (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid (CID 58915156) is (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid.
What is the SMILES notation for (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid?
The canonical SMILES for (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid is CCCC[C@@]1(C)C(C)=Nc2ccc(S(=O)(=O)O)cc21.
What is the InChIKey of (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid?
The InChIKey is YIOAWJNDESFUGW-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H19NO3S/c1-4-5-8-14(3)10(2)15-13-7-6-11(9-12(13)14)19(16,17)18/h6-7,9H,4-5,8H2,1-3H3,(H,16,17,18)/t14-/m0/s1.
What are the key properties of (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid?
(3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid has a molecular weight of 281.38 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-butyl-2,3-dimethylindole-5-sulfonic acid is sourced from PubChem (CID 58915156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).