About 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole
5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 58915262) has the molecular formula C16H12Cl2FN
and a molecular weight of 308.18 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole |
| PubChem CID | 58915262 |
| Molecular Formula | C16H12Cl2FN |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | Fc1ccc(C2CCC(c3c(Cl)cccc3Cl)=N2)cc1 |
| InChI | InChI=1S/C16H12Cl2FN/c17-12-2-1-3-13(18)16(12)15-9-8-14(20-15)10-4-6-11(19)7-5-10/h1-7,14H,8-9H2 |
| InChIKey | BNVJTTXPQDTFNE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole?
The IUPAC name of 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole (CID 58915262) is 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole is Fc1ccc(C2CCC(c3c(Cl)cccc3Cl)=N2)cc1.
What is the InChIKey of 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole?
The InChIKey is BNVJTTXPQDTFNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2FN/c17-12-2-1-3-13(18)16(12)15-9-8-14(20-15)10-4-6-11(19)7-5-10/h1-7,14H,8-9H2.
What are the key properties of 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole?
5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole has a molecular weight of 308.18 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-dichlorophenyl)-2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 58915262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).