About 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole
5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 58915342) has the molecular formula C19H19F2NS
and a molecular weight of 331.43 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole |
| PubChem CID | 58915342 |
| Molecular Formula | C19H19F2NS |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | CC(C)Sc1ccc(C2CCC(c3c(F)cccc3F)=N2)cc1 |
| InChI | InChI=1S/C19H19F2NS/c1-12(2)23-14-8-6-13(7-9-14)17-10-11-18(22-17)19-15(20)4-3-5-16(19)21/h3-9,12,17H,10-11H2,1-2H3 |
| InChIKey | HJTUVYHHAGCIOP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole?
The IUPAC name of 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole (CID 58915342) is 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole is CC(C)Sc1ccc(C2CCC(c3c(F)cccc3F)=N2)cc1.
What is the InChIKey of 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole?
The InChIKey is HJTUVYHHAGCIOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F2NS/c1-12(2)23-14-8-6-13(7-9-14)17-10-11-18(22-17)19-15(20)4-3-5-16(19)21/h3-9,12,17H,10-11H2,1-2H3.
What are the key properties of 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole?
5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole has a molecular weight of 331.43 g/mol, XLogP of 5.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-difluorophenyl)-2-(4-propan-2-ylsulfanylphenyl)-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 58915342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).