C23H15F6NO — CID 58915354
2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-5-(2,3,6-trifluorophenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 58915354) has the molecular formula C23H15F6NO and a molecular weight of 435.37 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-5-(2,3,6-trifluorophenyl)-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-5-(2,3,6-trifluorophenyl)-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 58915354 |
| Molecular Formula | C23H15F6NO |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-5-(2,3,6-trifluorophenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | Fc1ccc(F)c(C2=NC(c3ccc(-c4ccc(OC(F)(F)F)cc4)cc3)CC2)c1F |
| InChI | InChI=1S/C23H15F6NO/c24-17-9-10-18(25)22(26)21(17)20-12-11-19(30-20)15-3-1-13(2-4-15)14-5-7-16(8-6-14)31-23(27,28)29/h1-10,19H,11-12H2 |
| InChIKey | UUVGWVSPRSZCDW-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|