C11H6F16 — CID 58915554
4-(2,2-difluoroethenyl)-1,1,1,2,6,7,7,7-octafluoro-2,6-bis(trifluoromethyl)heptane (PubChem CID 58915554) has the molecular formula C11H6F16 and a molecular weight of 442.14 g/mol. Its IUPAC name is 4-(2,2-difluoroethenyl)-1,1,1,2,6,7,7,7-octafluoro-2,6-bis(trifluoromethyl)heptane.
| Compound Name | 4-(2,2-difluoroethenyl)-1,1,1,2,6,7,7,7-octafluoro-2,6-bis(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 58915554 |
| Molecular Formula | C11H6F16 |
| Molecular Weight | 442.14 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 4-(2,2-difluoroethenyl)-1,1,1,2,6,7,7,7-octafluoro-2,6-bis(trifluoromethyl)heptane |
| SMILES | FC(F)=CC(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H6F16/c12-5(13)1-4(2-6(14,8(16,17)18)9(19,20)21)3-7(15,10(22,23)24)11(25,26)27/h1,4H,2-3H2 |
| InChIKey | NMSKRTORHHFOJC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.14 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |