C11H7F15 — CID 58915558
1,1,1,2,6,7,7,7-octafluoro-4-[(E)-2-fluoroethenyl]-2,6-bis(trifluoromethyl)heptane (PubChem CID 58915558) has the molecular formula C11H7F15 and a molecular weight of 424.15 g/mol. Its IUPAC name is 1,1,1,2,6,7,7,7-octafluoro-4-[(E)-2-fluoroethenyl]-2,6-bis(trifluoromethyl)heptane.
| Compound Name | 1,1,1,2,6,7,7,7-octafluoro-4-[(E)-2-fluoroethenyl]-2,6-bis(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 58915558 |
| Molecular Formula | C11H7F15 |
| Molecular Weight | 424.15 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 1,1,1,2,6,7,7,7-octafluoro-4-[(E)-2-fluoroethenyl]-2,6-bis(trifluoromethyl)heptane |
| SMILES | F/C=C/C(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H7F15/c12-2-1-5(3-6(13,8(15,16)17)9(18,19)20)4-7(14,10(21,22)23)11(24,25)26/h1-2,5H,3-4H2/b2-1+ |
| InChIKey | BATXBKHJBOKIIV-OWOJBTEDSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.15 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |