C11H10F13I — CID 58915561
4-(2,2-difluoro-2-iodoethyl)-1,1,1,2,6,7,7,7-octafluoro-2-methyl-6-(trifluoromethyl)heptane (PubChem CID 58915561) has the molecular formula C11H10F13I and a molecular weight of 516.08 g/mol. Its IUPAC name is 4-(2,2-difluoro-2-iodoethyl)-1,1,1,2,6,7,7,7-octafluoro-2-methyl-6-(trifluoromethyl)heptane.
| Compound Name | 4-(2,2-difluoro-2-iodoethyl)-1,1,1,2,6,7,7,7-octafluoro-2-methyl-6-(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 58915561 |
| Molecular Formula | C11H10F13I |
| Molecular Weight | 516.08 g/mol |
| Exact Mass | 515.96 |
| IUPAC Name | 4-(2,2-difluoro-2-iodoethyl)-1,1,1,2,6,7,7,7-octafluoro-2-methyl-6-(trifluoromethyl)heptane |
| SMILES | CC(F)(CC(CC(F)(F)I)CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F13I/c1-6(12,9(16,17)18)2-5(4-8(14,15)25)3-7(13,10(19,20)21)11(22,23)24/h5H,2-4H2,1H3 |
| InChIKey | NIVHGLLLIJJTHM-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.08 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|