C10H4F16 — CID 58915577
1,1,5,6,6,6-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)hex-1-ene (PubChem CID 58915577) has the molecular formula C10H4F16 and a molecular weight of 428.11 g/mol. Its IUPAC name is 1,1,5,6,6,6-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)hex-1-ene.
| Compound Name | 1,1,5,6,6,6-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)hex-1-ene |
|---|---|
| PubChem CID | 58915577 |
| Molecular Formula | C10H4F16 |
| Molecular Weight | 428.11 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 1,1,5,6,6,6-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)hex-1-ene |
| SMILES | FC(F)=CC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4F16/c11-4(12)1-3(6(14,9(21,22)23)10(24,25)26)2-5(13,7(15,16)17)8(18,19)20/h1,3H,2H2 |
| InChIKey | YPNJMNXJECSCIQ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.11 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |