C10H3F17 — CID 58915578
1,1,2,5,6,6,6-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)hex-1-ene (PubChem CID 58915578) has the molecular formula C10H3F17 and a molecular weight of 446.10 g/mol. Its IUPAC name is 1,1,2,5,6,6,6-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)hex-1-ene.
| Compound Name | 1,1,2,5,6,6,6-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)hex-1-ene |
|---|---|
| PubChem CID | 58915578 |
| Molecular Formula | C10H3F17 |
| Molecular Weight | 446.10 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 1,1,2,5,6,6,6-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-(trifluoromethyl)hex-1-ene |
| SMILES | FC(F)=C(F)C(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H3F17/c11-3(4(12)13)2(6(15,9(22,23)24)10(25,26)27)1-5(14,7(16,17)18)8(19,20)21/h2H,1H2 |
| InChIKey | PQVCCBWUKBDYHQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.10 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |