C11H5F17 — CID 58915583
1,1,1,2,6,7,7,7-octafluoro-4-(1,2,2-trifluoroethenyl)-2,6-bis(trifluoromethyl)heptane (PubChem CID 58915583) has the molecular formula C11H5F17 and a molecular weight of 460.13 g/mol. Its IUPAC name is 1,1,1,2,6,7,7,7-octafluoro-4-(1,2,2-trifluoroethenyl)-2,6-bis(trifluoromethyl)heptane.
| Compound Name | 1,1,1,2,6,7,7,7-octafluoro-4-(1,2,2-trifluoroethenyl)-2,6-bis(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 58915583 |
| Molecular Formula | C11H5F17 |
| Molecular Weight | 460.13 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 1,1,1,2,6,7,7,7-octafluoro-4-(1,2,2-trifluoroethenyl)-2,6-bis(trifluoromethyl)heptane |
| SMILES | FC(F)=C(F)C(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H5F17/c12-4(5(13)14)3(1-6(15,8(17,18)19)9(20,21)22)2-7(16,10(23,24)25)11(26,27)28/h3H,1-2H2 |
| InChIKey | HLVYORMWLJSUGC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.13 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |