C19H26O2 — CID 58916156
(10R,13R)-10-hydroxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 58916156) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (10R,13R)-10-hydroxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13R)-10-hydroxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 58916156 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (10R,13R)-10-hydroxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1CCC2C3CCC4=CC(=O)C=C[C@@]4(O)C3CC[C@]12C |
| InChI | InChI=1S/C19H26O2/c1-12-3-6-16-15-5-4-13-11-14(20)7-10-19(13,21)17(15)8-9-18(12,16)2/h7,10-12,15-17,21H,3-6,8-9H2,1-2H3/t12?,15?,16?,17?,18-,19+/m1/s1 |
| InChIKey | WHLNYOWDMNVYJC-ZYCGGHBKSA-N |
| XLogP | 3.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |