About 1,5,5-trimethylazocane
1,5,5-trimethylazocane (PubChem CID 58916216) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is 1,5,5-trimethylazocane.
Molecular Properties
| Compound Name | 1,5,5-trimethylazocane |
| PubChem CID | 58916216 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 1,5,5-trimethylazocane |
| SMILES | CN1CCCC(C)(C)CCC1 |
| InChI | InChI=1S/C10H21N/c1-10(2)6-4-8-11(3)9-5-7-10/h4-9H2,1-3H3 |
| InChIKey | MVZSXYVVQJTLFN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5,5-trimethylazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,5-trimethylazocane?
The IUPAC name of 1,5,5-trimethylazocane (CID 58916216) is 1,5,5-trimethylazocane.
What is the SMILES notation for 1,5,5-trimethylazocane?
The canonical SMILES for 1,5,5-trimethylazocane is CN1CCCC(C)(C)CCC1.
What is the InChIKey of 1,5,5-trimethylazocane?
The InChIKey is MVZSXYVVQJTLFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-10(2)6-4-8-11(3)9-5-7-10/h4-9H2,1-3H3.
What are the key properties of 1,5,5-trimethylazocane?
1,5,5-trimethylazocane has a molecular weight of 155.28 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,5-trimethylazocane is sourced from PubChem (CID 58916216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).