About 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole
1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole (PubChem CID 58916423) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole.
Molecular Properties
| Compound Name | 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole |
| PubChem CID | 58916423 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole |
| SMILES | CC(C)CC1=CN(C)C2C=CC=CC12 |
| InChI | InChI=1S/C13H19N/c1-10(2)8-11-9-14(3)13-7-5-4-6-12(11)13/h4-7,9-10,12-13H,8H2,1-3H3 |
| InChIKey | SMBSBYCAXYNXRI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole?
The IUPAC name of 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole (CID 58916423) is 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole.
What is the SMILES notation for 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole?
The canonical SMILES for 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole is CC(C)CC1=CN(C)C2C=CC=CC12.
What is the InChIKey of 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole?
The InChIKey is SMBSBYCAXYNXRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-10(2)8-11-9-14(3)13-7-5-4-6-12(11)13/h4-7,9-10,12-13H,8H2,1-3H3.
What are the key properties of 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole?
1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole has a molecular weight of 189.30 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(2-methylpropyl)-3a,7a-dihydroindole is sourced from PubChem (CID 58916423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).