C34H28F2N6O4 — CID 58916547
7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide (PubChem CID 58916547) has the molecular formula C34H28F2N6O4 and a molecular weight of 622.63 g/mol. Its IUPAC name is 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide.
| Compound Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide |
|---|---|
| PubChem CID | 58916547 |
| Molecular Formula | C34H28F2N6O4 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide |
| SMILES | CC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc(F)c(F)c2)nc2c(C(=O)Nc3ccccc3)cnn12 |
| InChI | InChI=1S/C34H28F2N6O4/c1-18-22(19(2)43)9-10-24-23(18)11-13-28(24)41-34(46)30-15-29(33(45)37-16-20-8-12-26(35)27(36)14-20)40-31-25(17-38-42(30)31)32(44)39-21-6-4-3-5-7-21/h3-10,12,14-15,17,28H,11,13,16H2,1-2H3,(H,37,45)(H,39,44)(H,41,46)/t28-/m0/s1 |
| InChIKey | OIIHXBQMKBVJJS-NDEPHWFRSA-N |
| XLogP | 5.12 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |