About (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide
(2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide (PubChem CID 58916567) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide.
Molecular Properties
| Compound Name | (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide |
| PubChem CID | 58916567 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide |
| SMILES | CC(C)[C@@H](C)C(=O)NC12CCC(C)(CC1)CC2 |
| InChI | InChI=1S/C15H27NO/c1-11(2)12(3)13(17)16-15-8-5-14(4,6-9-15)7-10-15/h11-12H,5-10H2,1-4H3,(H,16,17)/t12-,14?,15?/m1/s1 |
| InChIKey | QTBMGEZJBUDPQZ-LRVUVFPRSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide?
The IUPAC name of (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide (CID 58916567) is (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide.
What is the SMILES notation for (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide?
The canonical SMILES for (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide is CC(C)[C@@H](C)C(=O)NC12CCC(C)(CC1)CC2.
What is the InChIKey of (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide?
The InChIKey is QTBMGEZJBUDPQZ-LRVUVFPRSA-N. The full InChI is InChI=1S/C15H27NO/c1-11(2)12(3)13(17)16-15-8-5-14(4,6-9-15)7-10-15/h11-12H,5-10H2,1-4H3,(H,16,17)/t12-,14?,15?/m1/s1.
What are the key properties of (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide?
(2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide has a molecular weight of 237.39 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,3-dimethyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)butanamide is sourced from PubChem (CID 58916567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).