C35H30F2N6O4 — CID 58916575
7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-(2-methylphenyl)pyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide (PubChem CID 58916575) has the molecular formula C35H30F2N6O4 and a molecular weight of 636.66 g/mol. Its IUPAC name is 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-(2-methylphenyl)pyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide.
| Compound Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-(2-methylphenyl)pyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide |
|---|---|
| PubChem CID | 58916575 |
| Molecular Formula | C35H30F2N6O4 |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(3,4-difluorophenyl)methyl]-3-N-(2-methylphenyl)pyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide |
| SMILES | CC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc(F)c(F)c2)nc2c(C(=O)Nc3ccccc3C)cnn12 |
| InChI | InChI=1S/C35H30F2N6O4/c1-18-6-4-5-7-28(18)41-33(45)25-17-39-43-31(35(47)42-29-13-11-23-19(2)22(20(3)44)9-10-24(23)29)15-30(40-32(25)43)34(46)38-16-21-8-12-26(36)27(37)14-21/h4-10,12,14-15,17,29H,11,13,16H2,1-3H3,(H,38,46)(H,41,45)(H,42,47)/t29-/m0/s1 |
| InChIKey | GPZAWUVTJVFVBW-LJAQVGFWSA-N |
| XLogP | 5.43 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |