C34H26ClF3N6O4 — CID 58916644
7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-3-N-(2-chlorophenyl)-5-N-[(3,4,5-trifluorophenyl)methyl]pyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide (PubChem CID 58916644) has the molecular formula C34H26ClF3N6O4 and a molecular weight of 675.07 g/mol. Its IUPAC name is 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-3-N-(2-chlorophenyl)-5-N-[(3,4,5-trifluorophenyl)methyl]pyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide.
| Compound Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-3-N-(2-chlorophenyl)-5-N-[(3,4,5-trifluorophenyl)methyl]pyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide |
|---|---|
| PubChem CID | 58916644 |
| Molecular Formula | C34H26ClF3N6O4 |
| Molecular Weight | 675.07 g/mol |
| Exact Mass | 674.17 |
| IUPAC Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-3-N-(2-chlorophenyl)-5-N-[(3,4,5-trifluorophenyl)methyl]pyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide |
| SMILES | CC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2cc(F)c(F)c(F)c2)nc2c(C(=O)Nc3ccccc3Cl)cnn12 |
| InChI | InChI=1S/C34H26ClF3N6O4/c1-16-19(17(2)45)7-8-21-20(16)9-10-26(21)42-34(48)29-13-28(33(47)39-14-18-11-24(36)30(38)25(37)12-18)41-31-22(15-40-44(29)31)32(46)43-27-6-4-3-5-23(27)35/h3-8,11-13,15,26H,9-10,14H2,1-2H3,(H,39,47)(H,42,48)(H,43,46)/t26-/m0/s1 |
| InChIKey | YCRJCLVDXDZSDH-SANMLTNESA-N |
| XLogP | 5.91 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.07 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|