C35H28F2N6O6 — CID 58916736
7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide (PubChem CID 58916736) has the molecular formula C35H28F2N6O6 and a molecular weight of 666.64 g/mol. Its IUPAC name is 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide.
| Compound Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide |
|---|---|
| PubChem CID | 58916736 |
| Molecular Formula | C35H28F2N6O6 |
| Molecular Weight | 666.64 g/mol |
| Exact Mass | 666.20 |
| IUPAC Name | 7-N-[(1S)-5-acetyl-4-methyl-2,3-dihydro-1H-inden-1-yl]-5-N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-3-N-phenylpyrazolo[1,5-a]pyrimidine-3,5,7-tricarboxamide |
| SMILES | CC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc3c(c2)OC(F)(F)O3)nc2c(C(=O)Nc3ccccc3)cnn12 |
| InChI | InChI=1S/C35H28F2N6O6/c1-18-22(19(2)44)9-10-24-23(18)11-12-26(24)42-34(47)28-15-27(33(46)38-16-20-8-13-29-30(14-20)49-35(36,37)48-29)41-31-25(17-39-43(28)31)32(45)40-21-6-4-3-5-7-21/h3-10,13-15,17,26H,11-12,16H2,1-2H3,(H,38,46)(H,40,45)(H,42,47)/t26-/m0/s1 |
| InChIKey | NSPLNZHNRHCHMJ-SANMLTNESA-N |
| XLogP | 5.16 |
| TPSA | 153.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |