C19H28O2 — CID 58916984
(7R,9S)-8-benzyl-7,9-diethyl-1,4-dioxaspiro[4.5]decane (PubChem CID 58916984) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (7R,9S)-8-benzyl-7,9-diethyl-1,4-dioxaspiro[4.5]decane.
| Compound Name | (7R,9S)-8-benzyl-7,9-diethyl-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 58916984 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (7R,9S)-8-benzyl-7,9-diethyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CC[C@@H]1CC2(C[C@H](CC)C1Cc1ccccc1)OCCO2 |
| InChI | InChI=1S/C19H28O2/c1-3-16-13-19(20-10-11-21-19)14-17(4-2)18(16)12-15-8-6-5-7-9-15/h5-9,16-18H,3-4,10-14H2,1-2H3/t16-,17+,18? |
| InChIKey | HZALJFQJVODNBZ-JWTNVVGKSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |