About CID 58917008
CID 58917008 (PubChem CID 58917008) has the molecular formula C5H5BN2O2
and a molecular weight of 135.92 g/mol.
Molecular Properties
| Compound Name | CID 58917008 |
| PubChem CID | 58917008 |
| Molecular Formula | C5H5BN2O2 |
| Molecular Weight | 135.92 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | — |
| SMILES | [B]Nc1c(NC)c(=O)c1=O |
| InChI | InChI=1S/C5H5BN2O2/c1-7-2-3(8-6)5(10)4(2)9/h7-8H,1H3 |
| InChIKey | UIRZPVRZYWDYRF-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.92 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58917008 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58917008?
The IUPAC name of CID 58917008 (CID 58917008) is not available.
What is the SMILES notation for CID 58917008?
The canonical SMILES for CID 58917008 is [B]Nc1c(NC)c(=O)c1=O.
What is the InChIKey of CID 58917008?
The InChIKey is UIRZPVRZYWDYRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BN2O2/c1-7-2-3(8-6)5(10)4(2)9/h7-8H,1H3.
What are the key properties of CID 58917008?
CID 58917008 has a molecular weight of 135.92 g/mol, XLogP of -1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58917008 is sourced from PubChem (CID 58917008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).