C23H18N6O2 — CID 58917229
1-(3-ethynylphenyl)-3-[3-[6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]oxyphenyl]urea (PubChem CID 58917229) has the molecular formula C23H18N6O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 1-(3-ethynylphenyl)-3-[3-[6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(3-ethynylphenyl)-3-[3-[6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 58917229 |
| Molecular Formula | C23H18N6O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-(3-ethynylphenyl)-3-[3-[6-(1-methylpyrazol-4-yl)pyrimidin-4-yl]oxyphenyl]urea |
| SMILES | C#Cc1cccc(NC(=O)Nc2cccc(Oc3cc(-c4cnn(C)c4)ncn3)c2)c1 |
| InChI | InChI=1S/C23H18N6O2/c1-3-16-6-4-7-18(10-16)27-23(30)28-19-8-5-9-20(11-19)31-22-12-21(24-15-25-22)17-13-26-29(2)14-17/h1,4-15H,2H3,(H2,27,28,30) |
| InChIKey | IIDOYASGZQMRPG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|