C23H19F3N6O5 — CID 58917232
1-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-3-[4-[6-(1,3,4-oxadiazol-2-yl)pyrimidin-4-yl]oxyphenyl]urea (PubChem CID 58917232) has the molecular formula C23H19F3N6O5 and a molecular weight of 516.44 g/mol. Its IUPAC name is 1-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-3-[4-[6-(1,3,4-oxadiazol-2-yl)pyrimidin-4-yl]oxyphenyl]urea.
| Compound Name | 1-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-3-[4-[6-(1,3,4-oxadiazol-2-yl)pyrimidin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 58917232 |
| Molecular Formula | C23H19F3N6O5 |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 1-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]-3-[4-[6-(1,3,4-oxadiazol-2-yl)pyrimidin-4-yl]oxyphenyl]urea |
| SMILES | COCCOc1ccc(NC(=O)Nc2ccc(Oc3cc(-c4nnco4)ncn3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H19F3N6O5/c1-34-8-9-35-19-7-4-15(10-17(19)23(24,25)26)31-22(33)30-14-2-5-16(6-3-14)37-20-11-18(27-12-28-20)21-32-29-13-36-21/h2-7,10-13H,8-9H2,1H3,(H2,30,31,33) |
| InChIKey | QTYAQSVMAFMOHF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|