C38H35ClF5N3O5 — CID 58917380
N-[(2S)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide (PubChem CID 58917380) has the molecular formula C38H35ClF5N3O5 and a molecular weight of 744.16 g/mol. Its IUPAC name is N-[(2S)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide.
| Compound Name | N-[(2S)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide |
|---|---|
| PubChem CID | 58917380 |
| Molecular Formula | C38H35ClF5N3O5 |
| Molecular Weight | 744.16 g/mol |
| Exact Mass | 743.22 |
| IUPAC Name | N-[(2S)-1-(4-chlorophenyl)-3-[1-[2-[(2-oxopiperidin-1-yl)methyl]phenyl]piperidin-4-ylidene]propan-2-yl]-4-oxo-6-(1,1,2,2,2-pentafluoroethoxy)chromene-2-carboxamide |
| SMILES | O=C(N[C@H](C=C1CCN(c2ccccc2CN2CCCCC2=O)CC1)Cc1ccc(Cl)cc1)c1cc(=O)c2cc(OC(F)(F)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C38H35ClF5N3O5/c39-27-10-8-24(9-11-27)19-28(20-25-14-17-46(18-15-25)31-6-2-1-5-26(31)23-47-16-4-3-7-35(47)49)45-36(50)34-22-32(48)30-21-29(12-13-33(30)51-34)52-38(43,44)37(40,41)42/h1-2,5-6,8-13,20-22,28H,3-4,7,14-19,23H2,(H,45,50)/t28-/m0/s1 |
| InChIKey | IZUBTYXVVCWYCP-NDEPHWFRSA-N |
| XLogP | 8.06 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.16 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|