C40H43ClN2O5 — CID 58917681
6-butoxy-N-[(2S)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-4-oxochromene-2-carboxamide (PubChem CID 58917681) has the molecular formula C40H43ClN2O5 and a molecular weight of 667.25 g/mol. Its IUPAC name is 6-butoxy-N-[(2S)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-4-oxochromene-2-carboxamide.
| Compound Name | 6-butoxy-N-[(2S)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 58917681 |
| Molecular Formula | C40H43ClN2O5 |
| Molecular Weight | 667.25 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | 6-butoxy-N-[(2S)-1-(4-chlorophenyl)-3-[4-[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]cyclohexylidene]propan-2-yl]-4-oxochromene-2-carboxamide |
| SMILES | CCCCOc1ccc2oc(C(=O)N[C@H](C=C3CCC(c4ccccc4CN4CCCC4=O)CC3)Cc3ccc(Cl)cc3)cc(=O)c2c1 |
| InChI | InChI=1S/C40H43ClN2O5/c1-2-3-21-47-33-18-19-37-35(24-33)36(44)25-38(48-37)40(46)42-32(23-28-12-16-31(41)17-13-28)22-27-10-14-29(15-11-27)34-8-5-4-7-30(34)26-43-20-6-9-39(43)45/h4-5,7-8,12-13,16-19,22,24-25,29,32H,2-3,6,9-11,14-15,20-21,23,26H2,1H3,(H,42,46)/b27-22-/t29?,32-/m1/s1 |
| InChIKey | WEHPFVHTBYHMDA-YSCSUJGKSA-N |
| XLogP | 8.37 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.25 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|