About [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate
[(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate (PubChem CID 58918258) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate.
Molecular Properties
| Compound Name | [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate |
| PubChem CID | 58918258 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate |
| SMILES | CC(=O)OCCCC/C=C/C1(C)OCCO1 |
| InChI | InChI=1S/C12H20O4/c1-11(13)14-8-6-4-3-5-7-12(2)15-9-10-16-12/h5,7H,3-4,6,8-10H2,1-2H3/b7-5+ |
| InChIKey | WFUMFQJYUDHWQG-FNORWQNLSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate?
The IUPAC name of [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate (CID 58918258) is [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate.
What is the SMILES notation for [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate?
The canonical SMILES for [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate is CC(=O)OCCCC/C=C/C1(C)OCCO1.
What is the InChIKey of [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate?
The InChIKey is WFUMFQJYUDHWQG-FNORWQNLSA-N. The full InChI is InChI=1S/C12H20O4/c1-11(13)14-8-6-4-3-5-7-12(2)15-9-10-16-12/h5,7H,3-4,6,8-10H2,1-2H3/b7-5+.
What are the key properties of [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate?
[(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate has a molecular weight of 228.29 g/mol, XLogP of 2.04, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-6-(2-methyl-1,3-dioxolan-2-yl)hex-5-enyl] acetate is sourced from PubChem (CID 58918258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).