C30H10F6N8 — CID 58918525
2-[5-[cyano(isocyano)methylidene]-2,8-diphenyl-3,7-bis(trifluoromethyl)pyrazino[2,3-g]quinoxalin-10-ylidene]-2-isocyanoacetonitrile (PubChem CID 58918525) has the molecular formula C30H10F6N8 and a molecular weight of 596.45 g/mol. Its IUPAC name is 2-[5-[cyano(isocyano)methylidene]-2,8-diphenyl-3,7-bis(trifluoromethyl)pyrazino[2,3-g]quinoxalin-10-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[5-[cyano(isocyano)methylidene]-2,8-diphenyl-3,7-bis(trifluoromethyl)pyrazino[2,3-g]quinoxalin-10-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 58918525 |
| Molecular Formula | C30H10F6N8 |
| Molecular Weight | 596.45 g/mol |
| Exact Mass | 596.09 |
| IUPAC Name | 2-[5-[cyano(isocyano)methylidene]-2,8-diphenyl-3,7-bis(trifluoromethyl)pyrazino[2,3-g]quinoxalin-10-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=c1c2nc(-c3ccccc3)c(C(F)(F)F)nc2c(=C(C#N)[N+]#[C-])c2nc(C(F)(F)F)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C30H10F6N8/c1-39-17(13-37)19-23-25(43-27(29(31,32)33)21(41-23)15-9-5-3-6-10-15)20(18(14-38)40-2)26-24(19)42-22(16-11-7-4-8-12-16)28(44-26)30(34,35)36/h3-12H/b19-17-,20-18+ |
| InChIKey | XFRIQIUULMQLHH-YAFCTCPESA-N |
| XLogP | 6.05 |
| TPSA | 107.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|