C15H13F5O6 — CID 58918627
2,2,3,3,3-pentafluoropropyl 5-oxo-2-prop-2-enoyloxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58918627) has the molecular formula C15H13F5O6 and a molecular weight of 384.25 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 5-oxo-2-prop-2-enoyloxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 5-oxo-2-prop-2-enoyloxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 58918627 |
| Molecular Formula | C15H13F5O6 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 5-oxo-2-prop-2-enoyloxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | C=CC(=O)OC1C2CC3C1OC(=O)C3C2C(=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H13F5O6/c1-2-7(21)25-10-5-3-6-9(13(23)26-11(6)10)8(5)12(22)24-4-14(16,17)15(18,19)20/h2,5-6,8-11H,1,3-4H2 |
| InChIKey | SXZRFOJCWQDOAT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|