C12H21F7NO2S+ — CID 58918793
trimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium (PubChem CID 58918793) has the molecular formula C12H21F7NO2S+ and a molecular weight of 376.36 g/mol. Its IUPAC name is trimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium.
| Compound Name | trimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium |
|---|---|
| PubChem CID | 58918793 |
| Molecular Formula | C12H21F7NO2S+ |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | trimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium |
| SMILES | C[N+](C)(C)CCCCS(=O)(=O)CCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H21F7NO2S/c1-20(2,3)7-4-5-8-23(21,22)9-6-10(13,11(14,15)16)12(17,18)19/h4-9H2,1-3H3/q+1 |
| InChIKey | YKFWTNYFAKAUAH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|