C18H25F7NO2S+ — CID 58918803
benzyl-dimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium (PubChem CID 58918803) has the molecular formula C18H25F7NO2S+ and a molecular weight of 452.46 g/mol. Its IUPAC name is benzyl-dimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium.
| Compound Name | benzyl-dimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium |
|---|---|
| PubChem CID | 58918803 |
| Molecular Formula | C18H25F7NO2S+ |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | benzyl-dimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium |
| SMILES | C[N+](C)(CCCCS(=O)(=O)CCC(F)(C(F)(F)F)C(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C18H25F7NO2S/c1-26(2,14-15-8-4-3-5-9-15)11-6-7-12-29(27,28)13-10-16(19,17(20,21)22)18(23,24)25/h3-5,8-9H,6-7,10-14H2,1-2H3/q+1 |
| InChIKey | OAEMZAGDZZCXEY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|