C9H14F7IN2O2S — CID 58918820
3,4,4,4-tetrafluoro-N-[3-[iodo(methyl)amino]propyl]-3-(trifluoromethyl)butane-1-sulfonamide (PubChem CID 58918820) has the molecular formula C9H14F7IN2O2S and a molecular weight of 474.18 g/mol. Its IUPAC name is 3,4,4,4-tetrafluoro-N-[3-[iodo(methyl)amino]propyl]-3-(trifluoromethyl)butane-1-sulfonamide.
| Compound Name | 3,4,4,4-tetrafluoro-N-[3-[iodo(methyl)amino]propyl]-3-(trifluoromethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 58918820 |
| Molecular Formula | C9H14F7IN2O2S |
| Molecular Weight | 474.18 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | 3,4,4,4-tetrafluoro-N-[3-[iodo(methyl)amino]propyl]-3-(trifluoromethyl)butane-1-sulfonamide |
| SMILES | CN(I)CCCNS(=O)(=O)CCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F7IN2O2S/c1-19(17)5-2-4-18-22(20,21)6-3-7(10,8(11,12)13)9(14,15)16/h18H,2-6H2,1H3 |
| InChIKey | GWRGJDNLBJHKCL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|