C11H18F7NO3S — CID 58918825
N,N-dimethyl-4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutan-1-amine oxide (PubChem CID 58918825) has the molecular formula C11H18F7NO3S and a molecular weight of 377.32 g/mol. Its IUPAC name is N,N-dimethyl-4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutan-1-amine oxide.
| Compound Name | N,N-dimethyl-4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutan-1-amine oxide |
|---|---|
| PubChem CID | 58918825 |
| Molecular Formula | C11H18F7NO3S |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N,N-dimethyl-4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutan-1-amine oxide |
| SMILES | C[N+](C)([O-])CCCCS(=O)(=O)CCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H18F7NO3S/c1-19(2,20)6-3-4-7-23(21,22)8-5-9(12,10(13,14)15)11(16,17)18/h3-8H2,1-2H3 |
| InChIKey | WXOBJXLKSUXGQA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|