C30H49N3O4 — CID 58918923
tert-butyl N-[(E,4S,7S)-7-benzyl-8-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-methyl-8-oxooct-5-en-4-yl]carbamate (PubChem CID 58918923) has the molecular formula C30H49N3O4 and a molecular weight of 515.74 g/mol. Its IUPAC name is tert-butyl N-[(E,4S,7S)-7-benzyl-8-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-methyl-8-oxooct-5-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(E,4S,7S)-7-benzyl-8-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-methyl-8-oxooct-5-en-4-yl]carbamate |
|---|---|
| PubChem CID | 58918923 |
| Molecular Formula | C30H49N3O4 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.37 |
| IUPAC Name | tert-butyl N-[(E,4S,7S)-7-benzyl-8-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-methyl-8-oxooct-5-en-4-yl]carbamate |
| SMILES | CC(C)C[C@@H](/C=C/[C@H](Cc1ccccc1)C(=O)NC1CC(C)(C)N(O)C(C)(C)C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H49N3O4/c1-21(2)17-24(32-27(35)37-28(3,4)5)16-15-23(18-22-13-11-10-12-14-22)26(34)31-25-19-29(6,7)33(36)30(8,9)20-25/h10-16,21,23-25,36H,17-20H2,1-9H3,(H,31,34)(H,32,35)/b16-15+/t23-,24-/m1/s1 |
| InChIKey | DUYHBXDGGSPLAA-KDBREVJYSA-N |
| XLogP | 5.87 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|