C20H24FN3O2 — CID 58919233
benzyl (2R)-4-[(3-amino-2-fluorophenyl)methyl]-2-methylpiperazine-1-carboxylate (PubChem CID 58919233) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is benzyl (2R)-4-[(3-amino-2-fluorophenyl)methyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | benzyl (2R)-4-[(3-amino-2-fluorophenyl)methyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 58919233 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | benzyl (2R)-4-[(3-amino-2-fluorophenyl)methyl]-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(Cc2cccc(N)c2F)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H24FN3O2/c1-15-12-23(13-17-8-5-9-18(22)19(17)21)10-11-24(15)20(25)26-14-16-6-3-2-4-7-16/h2-9,15H,10-14,22H2,1H3/t15-/m1/s1 |
| InChIKey | OBIHULPDNKYAKX-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|