C28H36N4O3 — CID 58919356
tert-butyl (3aS,9bS)-8-(4-methylpiperazine-1-carbonyl)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate (PubChem CID 58919356) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is tert-butyl (3aS,9bS)-8-(4-methylpiperazine-1-carbonyl)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate.
| Compound Name | tert-butyl (3aS,9bS)-8-(4-methylpiperazine-1-carbonyl)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 58919356 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | tert-butyl (3aS,9bS)-8-(4-methylpiperazine-1-carbonyl)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
| SMILES | CN1CCN(C(=O)c2ccc3c(c2)[C@@H]2[C@@H](CCN2C(=O)OC(C)(C)C)C(c2ccccc2)N3)CC1 |
| InChI | InChI=1S/C28H36N4O3/c1-28(2,3)35-27(34)32-13-12-21-24(19-8-6-5-7-9-19)29-23-11-10-20(18-22(23)25(21)32)26(33)31-16-14-30(4)15-17-31/h5-11,18,21,24-25,29H,12-17H2,1-4H3/t21-,24?,25-/m0/s1 |
| InChIKey | BUCUWMCYYQJQAZ-BIYQJSDESA-N |
| XLogP | 4.54 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |