C27H32N2O5 — CID 58919369
9-O-ethyl 1-O-prop-2-enyl (4aS,10bS)-5-(4-ethoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1,9-dicarboxylate (PubChem CID 58919369) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is 9-O-ethyl 1-O-prop-2-enyl (4aS,10bS)-5-(4-ethoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1,9-dicarboxylate.
| Compound Name | 9-O-ethyl 1-O-prop-2-enyl (4aS,10bS)-5-(4-ethoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1,9-dicarboxylate |
|---|---|
| PubChem CID | 58919369 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 9-O-ethyl 1-O-prop-2-enyl (4aS,10bS)-5-(4-ethoxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1,9-dicarboxylate |
| SMILES | C=CCOC(=O)N1CCC[C@H]2C(c3ccc(OCC)cc3)Nc3ccc(C(=O)OCC)cc3[C@H]21 |
| InChI | InChI=1S/C27H32N2O5/c1-4-16-34-27(31)29-15-7-8-21-24(18-9-12-20(13-10-18)32-5-2)28-23-14-11-19(26(30)33-6-3)17-22(23)25(21)29/h4,9-14,17,21,24-25,28H,1,5-8,15-16H2,2-3H3/t21-,24?,25-/m0/s1 |
| InChIKey | GIJDFLQBWPRSPO-BIYQJSDESA-N |
| XLogP | 5.50 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|