C34H26ClF9N2O5 — CID 58919963
5-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]pentanoic acid (PubChem CID 58919963) has the molecular formula C34H26ClF9N2O5 and a molecular weight of 749.03 g/mol. Its IUPAC name is 5-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]pentanoic acid.
| Compound Name | 5-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 58919963 |
| Molecular Formula | C34H26ClF9N2O5 |
| Molecular Weight | 749.03 g/mol |
| Exact Mass | 748.14 |
| IUPAC Name | 5-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]pentanoic acid |
| SMILES | O=C(O)CCCCOc1ccc(C[C@](NC(=O)c2ccc(F)c(C(F)(F)F)c2)(c2cc(F)cc(OC(F)(F)C(F)F)c2)c2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C34H26ClF9N2O5/c35-22-7-11-28(45-18-22)32(21-14-23(36)16-25(15-21)51-34(43,44)31(38)39,46-30(49)20-6-10-27(37)26(13-20)33(40,41)42)17-19-4-8-24(9-5-19)50-12-2-1-3-29(47)48/h4-11,13-16,18,31H,1-3,12,17H2,(H,46,49)(H,47,48)/t32-/m0/s1 |
| InChIKey | DGPWWEIGKJOOKN-YTTGMZPUSA-N |
| XLogP | 8.82 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.03 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|