C37H32ClF9N2O5 — CID 58920061
ethyl 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]hexanoate (PubChem CID 58920061) has the molecular formula C37H32ClF9N2O5 and a molecular weight of 791.11 g/mol. Its IUPAC name is ethyl 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]hexanoate.
| Compound Name | ethyl 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 58920061 |
| Molecular Formula | C37H32ClF9N2O5 |
| Molecular Weight | 791.11 g/mol |
| Exact Mass | 790.19 |
| IUPAC Name | ethyl 6-[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-fluoro-3-(trifluoromethyl)benzoyl]amino]ethyl]phenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccc(C[C@](NC(=O)c2ccc(F)c(C(F)(F)F)c2)(c2cc(F)cc(OC(F)(F)C(F)F)c2)c2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C37H32ClF9N2O5/c1-2-52-32(50)6-4-3-5-15-53-27-11-7-22(8-12-27)20-35(31-14-10-25(38)21-48-31,24-17-26(39)19-28(18-24)54-37(46,47)34(41)42)49-33(51)23-9-13-30(40)29(16-23)36(43,44)45/h7-14,16-19,21,34H,2-6,15,20H2,1H3,(H,49,51)/t35-/m0/s1 |
| InChIKey | VMYLQMMAYIDELJ-DHUJRADRSA-N |
| XLogP | 9.69 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.11 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|