C27H18ClF6N3O — CID 58920158
1-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(trifluoromethyl)phenyl]ethyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 58920158) has the molecular formula C27H18ClF6N3O and a molecular weight of 549.90 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(trifluoromethyl)phenyl]ethyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(trifluoromethyl)phenyl]ethyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 58920158 |
| Molecular Formula | C27H18ClF6N3O |
| Molecular Weight | 549.90 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 1-[1-(5-chloro-2-pyridinyl)-2-phenyl-1-[3-(trifluoromethyl)phenyl]ethyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)NC(Cc1ccccc1)(c1cccc(C(F)(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C27H18ClF6N3O/c28-19-9-12-22(35-15-19)26(14-16-5-2-1-3-6-16,17-7-4-8-18(13-17)27(32,33)34)37-25(38)36-21-11-10-20(29)23(30)24(21)31/h1-13,15H,14H2,(H2,36,37,38) |
| InChIKey | VYADINPUYRSDDY-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.90 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|