C37H42ClF5N4O5 — CID 58920241
ethyl 6-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclohexanecarbonyl]amino]hexanoate (PubChem CID 58920241) has the molecular formula C37H42ClF5N4O5 and a molecular weight of 753.21 g/mol. Its IUPAC name is ethyl 6-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclohexanecarbonyl]amino]hexanoate.
| Compound Name | ethyl 6-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclohexanecarbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 58920241 |
| Molecular Formula | C37H42ClF5N4O5 |
| Molecular Weight | 753.21 g/mol |
| Exact Mass | 752.28 |
| IUPAC Name | ethyl 6-[[(1S,2R)-2-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]cyclohexanecarbonyl]amino]hexanoate |
| SMILES | CCOC(=O)CCCCCNC(=O)[C@H]1CCCC[C@H]1NC(=O)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C37H42ClF5N4O5/c1-2-51-32(48)15-7-4-10-18-44-33(49)29-13-8-9-14-30(29)46-35(50)47-36(22-24-11-5-3-6-12-24,31-17-16-26(38)23-45-31)25-19-27(39)21-28(20-25)52-37(42,43)34(40)41/h3,5-6,11-12,16-17,19-21,23,29-30,34H,2,4,7-10,13-15,18,22H2,1H3,(H,44,49)(H2,46,47,50)/t29-,30+,36-/m0/s1 |
| InChIKey | OPDFQEYUMBQQIS-BLBFUMABSA-N |
| XLogP | 7.69 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.21 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|