C34H36ClF5N4O4 — CID 58920372
4-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(3-oxopentyl)cyclohexane-1-carboxamide (PubChem CID 58920372) has the molecular formula C34H36ClF5N4O4 and a molecular weight of 695.13 g/mol. Its IUPAC name is 4-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(3-oxopentyl)cyclohexane-1-carboxamide.
| Compound Name | 4-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(3-oxopentyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58920372 |
| Molecular Formula | C34H36ClF5N4O4 |
| Molecular Weight | 695.13 g/mol |
| Exact Mass | 694.23 |
| IUPAC Name | 4-[[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]carbamoylamino]-N-(3-oxopentyl)cyclohexane-1-carboxamide |
| SMILES | CCC(=O)CCNC(=O)C1CCC(NC(=O)N[C@@](Cc2ccccc2)(c2cc(F)cc(OC(F)(F)C(F)F)c2)c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C34H36ClF5N4O4/c1-2-27(45)14-15-41-30(46)22-8-11-26(12-9-22)43-32(47)44-33(19-21-6-4-3-5-7-21,29-13-10-24(35)20-42-29)23-16-25(36)18-28(17-23)48-34(39,40)31(37)38/h3-7,10,13,16-18,20,22,26,31H,2,8-9,11-12,14-15,19H2,1H3,(H,41,46)(H2,43,44,47)/t22?,26?,33-/m0/s1 |
| InChIKey | BMEJSWFYZOYEON-XKGPBUNQSA-N |
| XLogP | 6.94 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.13 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|